C17H15N5OS — CID 119060362
N-(3H-benzimidazol-5-ylmethyl)-1-methyl-5-thiophen-2-ylpyrazole-3-carboxamide (PubChem CID 119060362) has the molecular formula C17H15N5OS and a molecular weight of 337.41 g/mol. Its IUPAC name is N-(3H-benzimidazol-5-ylmethyl)-1-methyl-5-thiophen-2-ylpyrazole-3-carboxamide.
| Compound Name | N-(3H-benzimidazol-5-ylmethyl)-1-methyl-5-thiophen-2-ylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 119060362 |
| Molecular Formula | C17H15N5OS |
| Molecular Weight | 337.41 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | N-(3H-benzimidazol-5-ylmethyl)-1-methyl-5-thiophen-2-ylpyrazole-3-carboxamide |
| SMILES | Cn1nc(C(=O)NCc2ccc3nc[nH]c3c2)cc1-c1cccs1 |
| InChI | InChI=1S/C17H15N5OS/c1-22-15(16-3-2-6-24-16)8-14(21-22)17(23)18-9-11-4-5-12-13(7-11)20-10-19-12/h2-8,10H,9H2,1H3,(H,18,23)(H,19,20) |
| InChIKey | YWCAUUJSGPLEPT-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.41 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |