C20H31FN4O2 — CID 119062734
N-[2-(2-fluorophenyl)ethyl]-4-[4-(2-hydroxyethyl)piperazin-1-yl]piperidine-1-carboxamide (PubChem CID 119062734) has the molecular formula C20H31FN4O2 and a molecular weight of 378.49 g/mol. Its IUPAC name is N-[2-(2-fluorophenyl)ethyl]-4-[4-(2-hydroxyethyl)piperazin-1-yl]piperidine-1-carboxamide.
| Compound Name | N-[2-(2-fluorophenyl)ethyl]-4-[4-(2-hydroxyethyl)piperazin-1-yl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 119062734 |
| Molecular Formula | C20H31FN4O2 |
| Molecular Weight | 378.49 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | N-[2-(2-fluorophenyl)ethyl]-4-[4-(2-hydroxyethyl)piperazin-1-yl]piperidine-1-carboxamide |
| SMILES | O=C(NCCc1ccccc1F)N1CCC(N2CCN(CCO)CC2)CC1 |
| InChI | InChI=1S/C20H31FN4O2/c21-19-4-2-1-3-17(19)5-8-22-20(27)25-9-6-18(7-10-25)24-13-11-23(12-14-24)15-16-26/h1-4,18,26H,5-16H2,(H,22,27) |
| InChIKey | ODFWHSACQKDMBZ-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 59.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.49 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |