C22H36N4O4 — CID 154906520
N-[(2,3-dimethylphenyl)methyl]-4-[4-(2-hydroxyethyl)piperazin-1-yl]piperidine-1-carboxamide;formic acid (PubChem CID 154906520) has the molecular formula C22H36N4O4 and a molecular weight of 420.55 g/mol. Its IUPAC name is N-[(2,3-dimethylphenyl)methyl]-4-[4-(2-hydroxyethyl)piperazin-1-yl]piperidine-1-carboxamide;formic acid.
| Compound Name | N-[(2,3-dimethylphenyl)methyl]-4-[4-(2-hydroxyethyl)piperazin-1-yl]piperidine-1-carboxamide;formic acid |
|---|---|
| PubChem CID | 154906520 |
| Molecular Formula | C22H36N4O4 |
| Molecular Weight | 420.55 g/mol |
| Exact Mass | 420.27 |
| IUPAC Name | N-[(2,3-dimethylphenyl)methyl]-4-[4-(2-hydroxyethyl)piperazin-1-yl]piperidine-1-carboxamide;formic acid |
| SMILES | Cc1cccc(CNC(=O)N2CCC(N3CCN(CCO)CC3)CC2)c1C.O=CO |
| InChI | InChI=1S/C21H34N4O2.CH2O2/c1-17-4-3-5-19(18(17)2)16-22-21(27)25-8-6-20(7-9-25)24-12-10-23(11-13-24)14-15-26;2-1-3/h3-5,20,26H,6-16H2,1-2H3,(H,22,27);1H,(H,2,3) |
| InChIKey | KZLGQVLAEOGYEI-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 96.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.55 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|