About N-[(2,3-dimethylphenyl)methyl]-4-[(3S)-3-hydroxypiperidin-1-yl]piperidine-1-carboxamide
N-[(2,3-dimethylphenyl)methyl]-4-[(3S)-3-hydroxypiperidin-1-yl]piperidine-1-carboxamide (PubChem CID 126424306) has the molecular formula C20H31N3O2
and a molecular weight of 345.49 g/mol. Its IUPAC name is N-[(2,3-dimethylphenyl)methyl]-4-[(3S)-3-hydroxypiperidin-1-yl]piperidine-1-carboxamide.
Molecular Properties
| Compound Name | N-[(2,3-dimethylphenyl)methyl]-4-[(3S)-3-hydroxypiperidin-1-yl]piperidine-1-carboxamide |
| PubChem CID | 126424306 |
| Molecular Formula | C20H31N3O2 |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.24 |
| IUPAC Name | N-[(2,3-dimethylphenyl)methyl]-4-[(3S)-3-hydroxypiperidin-1-yl]piperidine-1-carboxamide |
| SMILES | Cc1cccc(CNC(=O)N2CCC(N3CCC[C@H](O)C3)CC2)c1C |
| InChI | InChI=1S/C20H31N3O2/c1-15-5-3-6-17(16(15)2)13-21-20(25)22-11-8-18(9-12-22)23-10-4-7-19(24)14-23/h3,5-6,18-19,24H,4,7-14H2,1-2H3,(H,21,25)/t19-/m0/s1 |
| InChIKey | BFYNWESHGJFRCH-IBGZPJMESA-N |
| XLogP | 2.43 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(2,3-dimethylphenyl)methyl]-4-[(3S)-3-hydroxypiperidin-1-yl]piperidine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2,3-dimethylphenyl)methyl]-4-[(3S)-3-hydroxypiperidin-1-yl]piperidine-1-carboxamide?
The IUPAC name of N-[(2,3-dimethylphenyl)methyl]-4-[(3S)-3-hydroxypiperidin-1-yl]piperidine-1-carboxamide (CID 126424306) is N-[(2,3-dimethylphenyl)methyl]-4-[(3S)-3-hydroxypiperidin-1-yl]piperidine-1-carboxamide.
What is the SMILES notation for N-[(2,3-dimethylphenyl)methyl]-4-[(3S)-3-hydroxypiperidin-1-yl]piperidine-1-carboxamide?
The canonical SMILES for N-[(2,3-dimethylphenyl)methyl]-4-[(3S)-3-hydroxypiperidin-1-yl]piperidine-1-carboxamide is Cc1cccc(CNC(=O)N2CCC(N3CCC[C@H](O)C3)CC2)c1C.
What is the InChIKey of N-[(2,3-dimethylphenyl)methyl]-4-[(3S)-3-hydroxypiperidin-1-yl]piperidine-1-carboxamide?
The InChIKey is BFYNWESHGJFRCH-IBGZPJMESA-N. The full InChI is InChI=1S/C20H31N3O2/c1-15-5-3-6-17(16(15)2)13-21-20(25)22-11-8-18(9-12-22)23-10-4-7-19(24)14-23/h3,5-6,18-19,24H,4,7-14H2,1-2H3,(H,21,25)/t19-/m0/s1.
What are the key properties of N-[(2,3-dimethylphenyl)methyl]-4-[(3S)-3-hydroxypiperidin-1-yl]piperidine-1-carboxamide?
N-[(2,3-dimethylphenyl)methyl]-4-[(3S)-3-hydroxypiperidin-1-yl]piperidine-1-carboxamide has a molecular weight of 345.49 g/mol, XLogP of 2.43, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2,3-dimethylphenyl)methyl]-4-[(3S)-3-hydroxypiperidin-1-yl]piperidine-1-carboxamide is sourced from PubChem (CID 126424306), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).