C15H18ClN5O — CID 119063045
(4-chloro-5-methyl-1H-pyrazol-3-yl)-[4-(pyridin-3-ylmethyl)piperazin-1-yl]methanone (PubChem CID 119063045) has the molecular formula C15H18ClN5O and a molecular weight of 319.80 g/mol. Its IUPAC name is (4-chloro-5-methyl-1H-pyrazol-3-yl)-[4-(pyridin-3-ylmethyl)piperazin-1-yl]methanone.
| Compound Name | (4-chloro-5-methyl-1H-pyrazol-3-yl)-[4-(pyridin-3-ylmethyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 119063045 |
| Molecular Formula | C15H18ClN5O |
| Molecular Weight | 319.80 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | (4-chloro-5-methyl-1H-pyrazol-3-yl)-[4-(pyridin-3-ylmethyl)piperazin-1-yl]methanone |
| SMILES | Cc1[nH]nc(C(=O)N2CCN(Cc3cccnc3)CC2)c1Cl |
| InChI | InChI=1S/C15H18ClN5O/c1-11-13(16)14(19-18-11)15(22)21-7-5-20(6-8-21)10-12-3-2-4-17-9-12/h2-4,9H,5-8,10H2,1H3,(H,18,19) |
| InChIKey | WFPDOHPGQOUNFR-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.80 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |