C13H15N3O2S — CID 119063934
6-(2,6-dimethoxyphenyl)-2-methylsulfanylpyrimidin-4-amine (PubChem CID 119063934) has the molecular formula C13H15N3O2S and a molecular weight of 277.35 g/mol. Its IUPAC name is 6-(2,6-dimethoxyphenyl)-2-methylsulfanylpyrimidin-4-amine.
| Compound Name | 6-(2,6-dimethoxyphenyl)-2-methylsulfanylpyrimidin-4-amine |
|---|---|
| PubChem CID | 119063934 |
| Molecular Formula | C13H15N3O2S |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | 6-(2,6-dimethoxyphenyl)-2-methylsulfanylpyrimidin-4-amine |
| SMILES | COc1cccc(OC)c1-c1cc(N)nc(SC)n1 |
| InChI | InChI=1S/C13H15N3O2S/c1-17-9-5-4-6-10(18-2)12(9)8-7-11(14)16-13(15-8)19-3/h4-7H,1-3H3,(H2,14,15,16) |
| InChIKey | ATNQRCGVOGEORP-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 70.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |