C16H17N5O3S — CID 119064670
2-(3-methyl-2,5-dioxoimidazolidin-1-yl)-N-[2-(2-pyridin-3-yl-1,3-thiazol-4-yl)ethyl]acetamide (PubChem CID 119064670) has the molecular formula C16H17N5O3S and a molecular weight of 359.41 g/mol. Its IUPAC name is 2-(3-methyl-2,5-dioxoimidazolidin-1-yl)-N-[2-(2-pyridin-3-yl-1,3-thiazol-4-yl)ethyl]acetamide.
| Compound Name | 2-(3-methyl-2,5-dioxoimidazolidin-1-yl)-N-[2-(2-pyridin-3-yl-1,3-thiazol-4-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 119064670 |
| Molecular Formula | C16H17N5O3S |
| Molecular Weight | 359.41 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | 2-(3-methyl-2,5-dioxoimidazolidin-1-yl)-N-[2-(2-pyridin-3-yl-1,3-thiazol-4-yl)ethyl]acetamide |
| SMILES | CN1CC(=O)N(CC(=O)NCCc2csc(-c3cccnc3)n2)C1=O |
| InChI | InChI=1S/C16H17N5O3S/c1-20-9-14(23)21(16(20)24)8-13(22)18-6-4-12-10-25-15(19-12)11-3-2-5-17-7-11/h2-3,5,7,10H,4,6,8-9H2,1H3,(H,18,22) |
| InChIKey | SNZOAJUNHWWQGC-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.41 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|