C18H17F2NO — CID 119065438
N-cyclopropyl-4-(3,4-difluorophenyl)-N-ethylbenzamide (PubChem CID 119065438) has the molecular formula C18H17F2NO and a molecular weight of 301.34 g/mol. Its IUPAC name is N-cyclopropyl-4-(3,4-difluorophenyl)-N-ethylbenzamide.
| Compound Name | N-cyclopropyl-4-(3,4-difluorophenyl)-N-ethylbenzamide |
|---|---|
| PubChem CID | 119065438 |
| Molecular Formula | C18H17F2NO |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | N-cyclopropyl-4-(3,4-difluorophenyl)-N-ethylbenzamide |
| SMILES | CCN(C(=O)c1ccc(-c2ccc(F)c(F)c2)cc1)C1CC1 |
| InChI | InChI=1S/C18H17F2NO/c1-2-21(15-8-9-15)18(22)13-5-3-12(4-6-13)14-7-10-16(19)17(20)11-14/h3-7,10-11,15H,2,8-9H2,1H3 |
| InChIKey | PLUFNYOQPROYHJ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |