C21H29N5O — CID 119072487
3-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-1-methyl-1-(quinoxalin-2-ylmethyl)urea (PubChem CID 119072487) has the molecular formula C21H29N5O and a molecular weight of 367.50 g/mol. Its IUPAC name is 3-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-1-methyl-1-(quinoxalin-2-ylmethyl)urea.
| Compound Name | 3-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-1-methyl-1-(quinoxalin-2-ylmethyl)urea |
|---|---|
| PubChem CID | 119072487 |
| Molecular Formula | C21H29N5O |
| Molecular Weight | 367.50 g/mol |
| Exact Mass | 367.24 |
| IUPAC Name | 3-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-1-methyl-1-(quinoxalin-2-ylmethyl)urea |
| SMILES | CN(Cc1cnc2ccccc2n1)C(=O)NC[C@@H]1CCCN2CCCC[C@H]12 |
| InChI | InChI=1S/C21H29N5O/c1-25(15-17-14-22-18-8-2-3-9-19(18)24-17)21(27)23-13-16-7-6-12-26-11-5-4-10-20(16)26/h2-3,8-9,14,16,20H,4-7,10-13,15H2,1H3,(H,23,27)/t16-,20+/m0/s1 |
| InChIKey | ATAIBSXGZPREPZ-OXJNMPFZSA-N |
| XLogP | 3.04 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.50 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |