C18H20FN5O2 — CID 119073637
2-(2-aminoethoxy)-N-[3-(benzotriazol-1-yl)propyl]-5-fluorobenzamide (PubChem CID 119073637) has the molecular formula C18H20FN5O2 and a molecular weight of 357.39 g/mol. Its IUPAC name is 2-(2-aminoethoxy)-N-[3-(benzotriazol-1-yl)propyl]-5-fluorobenzamide.
| Compound Name | 2-(2-aminoethoxy)-N-[3-(benzotriazol-1-yl)propyl]-5-fluorobenzamide |
|---|---|
| PubChem CID | 119073637 |
| Molecular Formula | C18H20FN5O2 |
| Molecular Weight | 357.39 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | 2-(2-aminoethoxy)-N-[3-(benzotriazol-1-yl)propyl]-5-fluorobenzamide |
| SMILES | NCCOc1ccc(F)cc1C(=O)NCCCn1nnc2ccccc21 |
| InChI | InChI=1S/C18H20FN5O2/c19-13-6-7-17(26-11-8-20)14(12-13)18(25)21-9-3-10-24-16-5-2-1-4-15(16)22-23-24/h1-2,4-7,12H,3,8-11,20H2,(H,21,25) |
| InChIKey | OPOAHIVANRCGBJ-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.39 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|