C16H21N5O — CID 119074868
N'-[6-(oxolan-3-yl)pyrimidin-4-yl]-N-pyridin-3-ylpropane-1,3-diamine (PubChem CID 119074868) has the molecular formula C16H21N5O and a molecular weight of 299.38 g/mol. Its IUPAC name is N'-[6-(oxolan-3-yl)pyrimidin-4-yl]-N-pyridin-3-ylpropane-1,3-diamine.
| Compound Name | N'-[6-(oxolan-3-yl)pyrimidin-4-yl]-N-pyridin-3-ylpropane-1,3-diamine |
|---|---|
| PubChem CID | 119074868 |
| Molecular Formula | C16H21N5O |
| Molecular Weight | 299.38 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | N'-[6-(oxolan-3-yl)pyrimidin-4-yl]-N-pyridin-3-ylpropane-1,3-diamine |
| SMILES | c1cncc(NCCCNc2cc(C3CCOC3)ncn2)c1 |
| InChI | InChI=1S/C16H21N5O/c1-3-14(10-17-5-1)18-6-2-7-19-16-9-15(20-12-21-16)13-4-8-22-11-13/h1,3,5,9-10,12-13,18H,2,4,6-8,11H2,(H,19,20,21) |
| InChIKey | RMFRRFHGPFFJBZ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 71.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.38 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|