C19H26N6O2 — CID 126445763
1-[4-[(3S)-oxolan-3-yl]-6-[3-(pyridin-3-ylamino)propylamino]pyrimidin-2-yl]azetidin-3-ol (PubChem CID 126445763) has the molecular formula C19H26N6O2 and a molecular weight of 370.46 g/mol. Its IUPAC name is 1-[4-[(3S)-oxolan-3-yl]-6-[3-(pyridin-3-ylamino)propylamino]pyrimidin-2-yl]azetidin-3-ol.
| Compound Name | 1-[4-[(3S)-oxolan-3-yl]-6-[3-(pyridin-3-ylamino)propylamino]pyrimidin-2-yl]azetidin-3-ol |
|---|---|
| PubChem CID | 126445763 |
| Molecular Formula | C19H26N6O2 |
| Molecular Weight | 370.46 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | 1-[4-[(3S)-oxolan-3-yl]-6-[3-(pyridin-3-ylamino)propylamino]pyrimidin-2-yl]azetidin-3-ol |
| SMILES | OC1CN(c2nc(NCCCNc3cccnc3)cc([C@@H]3CCOC3)n2)C1 |
| InChI | InChI=1S/C19H26N6O2/c26-16-11-25(12-16)19-23-17(14-4-8-27-13-14)9-18(24-19)22-7-2-6-21-15-3-1-5-20-10-15/h1,3,5,9-10,14,16,21,26H,2,4,6-8,11-13H2,(H,22,23,24)/t14-/m1/s1 |
| InChIKey | TYGIJGNLAXSIPM-CQSZACIVSA-N |
| XLogP | 1.47 |
| TPSA | 95.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.46 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|