C16H23N7 — CID 91779112
6-(3-aminocyclobutyl)-4-N-[3-(pyridin-3-ylamino)propyl]pyrimidine-2,4-diamine (PubChem CID 91779112) has the molecular formula C16H23N7 and a molecular weight of 313.41 g/mol. Its IUPAC name is 6-(3-aminocyclobutyl)-4-N-[3-(pyridin-3-ylamino)propyl]pyrimidine-2,4-diamine.
| Compound Name | 6-(3-aminocyclobutyl)-4-N-[3-(pyridin-3-ylamino)propyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 91779112 |
| Molecular Formula | C16H23N7 |
| Molecular Weight | 313.41 g/mol |
| Exact Mass | 313.20 |
| IUPAC Name | 6-(3-aminocyclobutyl)-4-N-[3-(pyridin-3-ylamino)propyl]pyrimidine-2,4-diamine |
| SMILES | Nc1nc(NCCCNc2cccnc2)cc(C2CC(N)C2)n1 |
| InChI | InChI=1S/C16H23N7/c17-12-7-11(8-12)14-9-15(23-16(18)22-14)21-6-2-5-20-13-3-1-4-19-10-13/h1,3-4,9-12,20H,2,5-8,17H2,(H3,18,21,22,23) |
| InChIKey | BKBYOYLBBMYJMN-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 114.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.41 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|