C17H23N5 — CID 91766519
6-(3-aminocyclobutyl)-4-N-(3-phenylpropyl)pyrimidine-2,4-diamine (PubChem CID 91766519) has the molecular formula C17H23N5 and a molecular weight of 297.41 g/mol. Its IUPAC name is 6-(3-aminocyclobutyl)-4-N-(3-phenylpropyl)pyrimidine-2,4-diamine.
| Compound Name | 6-(3-aminocyclobutyl)-4-N-(3-phenylpropyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 91766519 |
| Molecular Formula | C17H23N5 |
| Molecular Weight | 297.41 g/mol |
| Exact Mass | 297.20 |
| IUPAC Name | 6-(3-aminocyclobutyl)-4-N-(3-phenylpropyl)pyrimidine-2,4-diamine |
| SMILES | Nc1nc(NCCCc2ccccc2)cc(C2CC(N)C2)n1 |
| InChI | InChI=1S/C17H23N5/c18-14-9-13(10-14)15-11-16(22-17(19)21-15)20-8-4-7-12-5-2-1-3-6-12/h1-3,5-6,11,13-14H,4,7-10,18H2,(H3,19,20,21,22) |
| InChIKey | JOGZSAJGBJVFGB-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 89.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.41 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|