C16H22N6 — CID 91787226
6-(3-aminocyclobutyl)-4-N-(3-pyridin-4-ylpropyl)pyrimidine-2,4-diamine (PubChem CID 91787226) has the molecular formula C16H22N6 and a molecular weight of 298.39 g/mol. Its IUPAC name is 6-(3-aminocyclobutyl)-4-N-(3-pyridin-4-ylpropyl)pyrimidine-2,4-diamine.
| Compound Name | 6-(3-aminocyclobutyl)-4-N-(3-pyridin-4-ylpropyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 91787226 |
| Molecular Formula | C16H22N6 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | 6-(3-aminocyclobutyl)-4-N-(3-pyridin-4-ylpropyl)pyrimidine-2,4-diamine |
| SMILES | Nc1nc(NCCCc2ccncc2)cc(C2CC(N)C2)n1 |
| InChI | InChI=1S/C16H22N6/c17-13-8-12(9-13)14-10-15(22-16(18)21-14)20-5-1-2-11-3-6-19-7-4-11/h3-4,6-7,10,12-13H,1-2,5,8-9,17H2,(H3,18,20,21,22) |
| InChIKey | PTEYUIXMSYLLKJ-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 102.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|