C18H24N4O2 — CID 91787964
3-[2-amino-6-[3-(4-methoxyphenyl)propylamino]pyrimidin-4-yl]cyclobutan-1-ol (PubChem CID 91787964) has the molecular formula C18H24N4O2 and a molecular weight of 328.42 g/mol. Its IUPAC name is 3-[2-amino-6-[3-(4-methoxyphenyl)propylamino]pyrimidin-4-yl]cyclobutan-1-ol.
| Compound Name | 3-[2-amino-6-[3-(4-methoxyphenyl)propylamino]pyrimidin-4-yl]cyclobutan-1-ol |
|---|---|
| PubChem CID | 91787964 |
| Molecular Formula | C18H24N4O2 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | 3-[2-amino-6-[3-(4-methoxyphenyl)propylamino]pyrimidin-4-yl]cyclobutan-1-ol |
| SMILES | COc1ccc(CCCNc2cc(C3CC(O)C3)nc(N)n2)cc1 |
| InChI | InChI=1S/C18H24N4O2/c1-24-15-6-4-12(5-7-15)3-2-8-20-17-11-16(21-18(19)22-17)13-9-14(23)10-13/h4-7,11,13-14,23H,2-3,8-10H2,1H3,(H3,19,20,21,22) |
| InChIKey | NXDFNJODQZOHLM-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 93.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|