C19H25N3O2 — CID 91793673
3-[6-[3-(4-methoxyphenyl)propylamino]-2-methylpyrimidin-4-yl]cyclobutan-1-ol (PubChem CID 91793673) has the molecular formula C19H25N3O2 and a molecular weight of 327.43 g/mol. Its IUPAC name is 3-[6-[3-(4-methoxyphenyl)propylamino]-2-methylpyrimidin-4-yl]cyclobutan-1-ol.
| Compound Name | 3-[6-[3-(4-methoxyphenyl)propylamino]-2-methylpyrimidin-4-yl]cyclobutan-1-ol |
|---|---|
| PubChem CID | 91793673 |
| Molecular Formula | C19H25N3O2 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.19 |
| IUPAC Name | 3-[6-[3-(4-methoxyphenyl)propylamino]-2-methylpyrimidin-4-yl]cyclobutan-1-ol |
| SMILES | COc1ccc(CCCNc2cc(C3CC(O)C3)nc(C)n2)cc1 |
| InChI | InChI=1S/C19H25N3O2/c1-13-21-18(15-10-16(23)11-15)12-19(22-13)20-9-3-4-14-5-7-17(24-2)8-6-14/h5-8,12,15-16,23H,3-4,9-11H2,1-2H3,(H,20,21,22) |
| InChIKey | YWXSCWYSENQNAR-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 67.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|