C13H25Cl2N5O — CID 154902821
6-(3-aminocyclobutyl)-4-N-(3-ethoxypropyl)pyrimidine-2,4-diamine;dihydrochloride (PubChem CID 154902821) has the molecular formula C13H25Cl2N5O and a molecular weight of 338.28 g/mol. Its IUPAC name is 6-(3-aminocyclobutyl)-4-N-(3-ethoxypropyl)pyrimidine-2,4-diamine;dihydrochloride.
| Compound Name | 6-(3-aminocyclobutyl)-4-N-(3-ethoxypropyl)pyrimidine-2,4-diamine;dihydrochloride |
|---|---|
| PubChem CID | 154902821 |
| Molecular Formula | C13H25Cl2N5O |
| Molecular Weight | 338.28 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | 6-(3-aminocyclobutyl)-4-N-(3-ethoxypropyl)pyrimidine-2,4-diamine;dihydrochloride |
| SMILES | CCOCCCNc1cc(C2CC(N)C2)nc(N)n1.Cl.Cl |
| InChI | InChI=1S/C13H23N5O.2ClH/c1-2-19-5-3-4-16-12-8-11(17-13(15)18-12)9-6-10(14)7-9;;/h8-10H,2-7,14H2,1H3,(H3,15,16,17,18);2*1H |
| InChIKey | RJPDMJSHXRWJNC-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 99.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.28 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|