C17H22N6O — CID 91791293
3-[[2-amino-6-(3-aminocyclobutyl)pyrimidin-4-yl]amino]-N-phenylpropanamide (PubChem CID 91791293) has the molecular formula C17H22N6O and a molecular weight of 326.40 g/mol. Its IUPAC name is 3-[[2-amino-6-(3-aminocyclobutyl)pyrimidin-4-yl]amino]-N-phenylpropanamide.
| Compound Name | 3-[[2-amino-6-(3-aminocyclobutyl)pyrimidin-4-yl]amino]-N-phenylpropanamide |
|---|---|
| PubChem CID | 91791293 |
| Molecular Formula | C17H22N6O |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | 3-[[2-amino-6-(3-aminocyclobutyl)pyrimidin-4-yl]amino]-N-phenylpropanamide |
| SMILES | Nc1nc(NCCC(=O)Nc2ccccc2)cc(C2CC(N)C2)n1 |
| InChI | InChI=1S/C17H22N6O/c18-12-8-11(9-12)14-10-15(23-17(19)22-14)20-7-6-16(24)21-13-4-2-1-3-5-13/h1-5,10-12H,6-9,18H2,(H,21,24)(H3,19,20,22,23) |
| InChIKey | LDBXTHRPHDRAMH-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 118.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |