C17H23Cl3N6O — CID 154901701
N-[2-[[2-amino-6-(3-aminocyclobutyl)pyrimidin-4-yl]amino]ethyl]-2-chlorobenzamide;dihydrochloride (PubChem CID 154901701) has the molecular formula C17H23Cl3N6O and a molecular weight of 433.77 g/mol. Its IUPAC name is N-[2-[[2-amino-6-(3-aminocyclobutyl)pyrimidin-4-yl]amino]ethyl]-2-chlorobenzamide;dihydrochloride.
| Compound Name | N-[2-[[2-amino-6-(3-aminocyclobutyl)pyrimidin-4-yl]amino]ethyl]-2-chlorobenzamide;dihydrochloride |
|---|---|
| PubChem CID | 154901701 |
| Molecular Formula | C17H23Cl3N6O |
| Molecular Weight | 433.77 g/mol |
| Exact Mass | 432.10 |
| IUPAC Name | N-[2-[[2-amino-6-(3-aminocyclobutyl)pyrimidin-4-yl]amino]ethyl]-2-chlorobenzamide;dihydrochloride |
| SMILES | Cl.Cl.Nc1nc(NCCNC(=O)c2ccccc2Cl)cc(C2CC(N)C2)n1 |
| InChI | InChI=1S/C17H21ClN6O.2ClH/c18-13-4-2-1-3-12(13)16(25)22-6-5-21-15-9-14(23-17(20)24-15)10-7-11(19)8-10;;/h1-4,9-11H,5-8,19H2,(H,22,25)(H3,20,21,23,24);2*1H |
| InChIKey | HIPOUYSNXTUDFV-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 118.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.77 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|