C17H20ClN5O2 — CID 91780839
N-[2-[[2-amino-6-(3-hydroxycyclobutyl)pyrimidin-4-yl]amino]ethyl]-2-chlorobenzamide (PubChem CID 91780839) has the molecular formula C17H20ClN5O2 and a molecular weight of 361.83 g/mol. Its IUPAC name is N-[2-[[2-amino-6-(3-hydroxycyclobutyl)pyrimidin-4-yl]amino]ethyl]-2-chlorobenzamide.
| Compound Name | N-[2-[[2-amino-6-(3-hydroxycyclobutyl)pyrimidin-4-yl]amino]ethyl]-2-chlorobenzamide |
|---|---|
| PubChem CID | 91780839 |
| Molecular Formula | C17H20ClN5O2 |
| Molecular Weight | 361.83 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | N-[2-[[2-amino-6-(3-hydroxycyclobutyl)pyrimidin-4-yl]amino]ethyl]-2-chlorobenzamide |
| SMILES | Nc1nc(NCCNC(=O)c2ccccc2Cl)cc(C2CC(O)C2)n1 |
| InChI | InChI=1S/C17H20ClN5O2/c18-13-4-2-1-3-12(13)16(25)21-6-5-20-15-9-14(22-17(19)23-15)10-7-11(24)8-10/h1-4,9-11,24H,5-8H2,(H,21,25)(H3,19,20,22,23) |
| InChIKey | ILUKCBSTDDYPCS-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 113.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.83 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|