C13H18N6OS2 — CID 91781311
3-[2-amino-6-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]ethylamino]pyrimidin-4-yl]cyclobutan-1-ol (PubChem CID 91781311) has the molecular formula C13H18N6OS2 and a molecular weight of 338.46 g/mol. Its IUPAC name is 3-[2-amino-6-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]ethylamino]pyrimidin-4-yl]cyclobutan-1-ol.
| Compound Name | 3-[2-amino-6-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]ethylamino]pyrimidin-4-yl]cyclobutan-1-ol |
|---|---|
| PubChem CID | 91781311 |
| Molecular Formula | C13H18N6OS2 |
| Molecular Weight | 338.46 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | 3-[2-amino-6-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]ethylamino]pyrimidin-4-yl]cyclobutan-1-ol |
| SMILES | Cc1nnc(SCCNc2cc(C3CC(O)C3)nc(N)n2)s1 |
| InChI | InChI=1S/C13H18N6OS2/c1-7-18-19-13(22-7)21-3-2-15-11-6-10(16-12(14)17-11)8-4-9(20)5-8/h6,8-9,20H,2-5H2,1H3,(H3,14,15,16,17) |
| InChIKey | JSQOUPXBMIORRS-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 109.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.46 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|