C18H26Cl2N6 — CID 154902435
N'-[6-(3-aminocyclobutyl)-2-cyclopropylpyrimidin-4-yl]-N-pyridin-3-ylethane-1,2-diamine;dihydrochloride (PubChem CID 154902435) has the molecular formula C18H26Cl2N6 and a molecular weight of 397.35 g/mol. Its IUPAC name is N'-[6-(3-aminocyclobutyl)-2-cyclopropylpyrimidin-4-yl]-N-pyridin-3-ylethane-1,2-diamine;dihydrochloride.
| Compound Name | N'-[6-(3-aminocyclobutyl)-2-cyclopropylpyrimidin-4-yl]-N-pyridin-3-ylethane-1,2-diamine;dihydrochloride |
|---|---|
| PubChem CID | 154902435 |
| Molecular Formula | C18H26Cl2N6 |
| Molecular Weight | 397.35 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | N'-[6-(3-aminocyclobutyl)-2-cyclopropylpyrimidin-4-yl]-N-pyridin-3-ylethane-1,2-diamine;dihydrochloride |
| SMILES | Cl.Cl.NC1CC(c2cc(NCCNc3cccnc3)nc(C3CC3)n2)C1 |
| InChI | InChI=1S/C18H24N6.2ClH/c19-14-8-13(9-14)16-10-17(24-18(23-16)12-3-4-12)22-7-6-21-15-2-1-5-20-11-15;;/h1-2,5,10-14,21H,3-4,6-9,19H2,(H,22,23,24);2*1H |
| InChIKey | HGRRUFMOJPFJCH-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 88.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.35 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|