C19H27N5S — CID 91761753
6-(3-aminocyclobutyl)-2-cyclopropyl-N-[3-(4,5-dimethyl-1,3-thiazol-2-yl)propyl]pyrimidin-4-amine (PubChem CID 91761753) has the molecular formula C19H27N5S and a molecular weight of 357.53 g/mol. Its IUPAC name is 6-(3-aminocyclobutyl)-2-cyclopropyl-N-[3-(4,5-dimethyl-1,3-thiazol-2-yl)propyl]pyrimidin-4-amine.
| Compound Name | 6-(3-aminocyclobutyl)-2-cyclopropyl-N-[3-(4,5-dimethyl-1,3-thiazol-2-yl)propyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 91761753 |
| Molecular Formula | C19H27N5S |
| Molecular Weight | 357.53 g/mol |
| Exact Mass | 357.20 |
| IUPAC Name | 6-(3-aminocyclobutyl)-2-cyclopropyl-N-[3-(4,5-dimethyl-1,3-thiazol-2-yl)propyl]pyrimidin-4-amine |
| SMILES | Cc1nc(CCCNc2cc(C3CC(N)C3)nc(C3CC3)n2)sc1C |
| InChI | InChI=1S/C19H27N5S/c1-11-12(2)25-18(22-11)4-3-7-21-17-10-16(14-8-15(20)9-14)23-19(24-17)13-5-6-13/h10,13-15H,3-9,20H2,1-2H3,(H,21,23,24) |
| InChIKey | XVYRVAKLXNRIIV-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.53 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|