C17H22N4S — CID 91795318
6-(3-aminocyclobutyl)-2-cyclopropyl-N-[(5-methylthiophen-2-yl)methyl]pyrimidin-4-amine (PubChem CID 91795318) has the molecular formula C17H22N4S and a molecular weight of 314.46 g/mol. Its IUPAC name is 6-(3-aminocyclobutyl)-2-cyclopropyl-N-[(5-methylthiophen-2-yl)methyl]pyrimidin-4-amine.
| Compound Name | 6-(3-aminocyclobutyl)-2-cyclopropyl-N-[(5-methylthiophen-2-yl)methyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 91795318 |
| Molecular Formula | C17H22N4S |
| Molecular Weight | 314.46 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | 6-(3-aminocyclobutyl)-2-cyclopropyl-N-[(5-methylthiophen-2-yl)methyl]pyrimidin-4-amine |
| SMILES | Cc1ccc(CNc2cc(C3CC(N)C3)nc(C3CC3)n2)s1 |
| InChI | InChI=1S/C17H22N4S/c1-10-2-5-14(22-10)9-19-16-8-15(12-6-13(18)7-12)20-17(21-16)11-3-4-11/h2,5,8,11-13H,3-4,6-7,9,18H2,1H3,(H,19,20,21) |
| InChIKey | CHDSOJUMGCOGKT-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.46 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |