C19H32Cl2N4S — CID 154901879
6-(3-aminocyclobutyl)-N-(2-cyclohexylsulfanylethyl)-2-cyclopropylpyrimidin-4-amine;dihydrochloride (PubChem CID 154901879) has the molecular formula C19H32Cl2N4S and a molecular weight of 419.47 g/mol. Its IUPAC name is 6-(3-aminocyclobutyl)-N-(2-cyclohexylsulfanylethyl)-2-cyclopropylpyrimidin-4-amine;dihydrochloride.
| Compound Name | 6-(3-aminocyclobutyl)-N-(2-cyclohexylsulfanylethyl)-2-cyclopropylpyrimidin-4-amine;dihydrochloride |
|---|---|
| PubChem CID | 154901879 |
| Molecular Formula | C19H32Cl2N4S |
| Molecular Weight | 419.47 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | 6-(3-aminocyclobutyl)-N-(2-cyclohexylsulfanylethyl)-2-cyclopropylpyrimidin-4-amine;dihydrochloride |
| SMILES | Cl.Cl.NC1CC(c2cc(NCCSC3CCCCC3)nc(C3CC3)n2)C1 |
| InChI | InChI=1S/C19H30N4S.2ClH/c20-15-10-14(11-15)17-12-18(23-19(22-17)13-6-7-13)21-8-9-24-16-4-2-1-3-5-16;;/h12-16H,1-11,20H2,(H,21,22,23);2*1H |
| InChIKey | XXHKRLTVKVSXCK-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.47 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|