C19H23ClN4O2 — CID 126436421
1-[4-[2-(3-chlorophenyl)ethylamino]-6-[(3R)-oxolan-3-yl]pyrimidin-2-yl]azetidin-3-ol (PubChem CID 126436421) has the molecular formula C19H23ClN4O2 and a molecular weight of 374.87 g/mol. Its IUPAC name is 1-[4-[2-(3-chlorophenyl)ethylamino]-6-[(3R)-oxolan-3-yl]pyrimidin-2-yl]azetidin-3-ol.
| Compound Name | 1-[4-[2-(3-chlorophenyl)ethylamino]-6-[(3R)-oxolan-3-yl]pyrimidin-2-yl]azetidin-3-ol |
|---|---|
| PubChem CID | 126436421 |
| Molecular Formula | C19H23ClN4O2 |
| Molecular Weight | 374.87 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | 1-[4-[2-(3-chlorophenyl)ethylamino]-6-[(3R)-oxolan-3-yl]pyrimidin-2-yl]azetidin-3-ol |
| SMILES | OC1CN(c2nc(NCCc3cccc(Cl)c3)cc([C@H]3CCOC3)n2)C1 |
| InChI | InChI=1S/C19H23ClN4O2/c20-15-3-1-2-13(8-15)4-6-21-18-9-17(14-5-7-26-12-14)22-19(23-18)24-10-16(25)11-24/h1-3,8-9,14,16,25H,4-7,10-12H2,(H,21,22,23)/t14-/m0/s1 |
| InChIKey | HDJNNQBSWYUQSJ-AWEZNQCLSA-N |
| XLogP | 2.47 |
| TPSA | 70.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.87 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |