C17H21ClN4O2 — CID 126430107
2-[[4-[(3-chlorophenyl)methylamino]-6-[(3S)-oxolan-3-yl]pyrimidin-2-yl]amino]ethanol (PubChem CID 126430107) has the molecular formula C17H21ClN4O2 and a molecular weight of 348.83 g/mol. Its IUPAC name is 2-[[4-[(3-chlorophenyl)methylamino]-6-[(3S)-oxolan-3-yl]pyrimidin-2-yl]amino]ethanol.
| Compound Name | 2-[[4-[(3-chlorophenyl)methylamino]-6-[(3S)-oxolan-3-yl]pyrimidin-2-yl]amino]ethanol |
|---|---|
| PubChem CID | 126430107 |
| Molecular Formula | C17H21ClN4O2 |
| Molecular Weight | 348.83 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | 2-[[4-[(3-chlorophenyl)methylamino]-6-[(3S)-oxolan-3-yl]pyrimidin-2-yl]amino]ethanol |
| SMILES | OCCNc1nc(NCc2cccc(Cl)c2)cc([C@@H]2CCOC2)n1 |
| InChI | InChI=1S/C17H21ClN4O2/c18-14-3-1-2-12(8-14)10-20-16-9-15(13-4-7-24-11-13)21-17(22-16)19-5-6-23/h1-3,8-9,13,23H,4-7,10-11H2,(H2,19,20,21,22)/t13-/m1/s1 |
| InChIKey | SDONUCPIRMXPEX-CYBMUJFWSA-N |
| XLogP | 2.65 |
| TPSA | 79.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.83 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |