C17H23N5O2 — CID 119068356
2-[[4-[(3-methyl-2-pyridinyl)methylamino]-6-(oxolan-3-yl)pyrimidin-2-yl]amino]ethanol (PubChem CID 119068356) has the molecular formula C17H23N5O2 and a molecular weight of 329.40 g/mol. Its IUPAC name is 2-[[4-[(3-methyl-2-pyridinyl)methylamino]-6-(oxolan-3-yl)pyrimidin-2-yl]amino]ethanol.
| Compound Name | 2-[[4-[(3-methyl-2-pyridinyl)methylamino]-6-(oxolan-3-yl)pyrimidin-2-yl]amino]ethanol |
|---|---|
| PubChem CID | 119068356 |
| Molecular Formula | C17H23N5O2 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.19 |
| IUPAC Name | 2-[[4-[(3-methyl-2-pyridinyl)methylamino]-6-(oxolan-3-yl)pyrimidin-2-yl]amino]ethanol |
| SMILES | Cc1cccnc1CNc1cc(C2CCOC2)nc(NCCO)n1 |
| InChI | InChI=1S/C17H23N5O2/c1-12-3-2-5-18-15(12)10-20-16-9-14(13-4-8-24-11-13)21-17(22-16)19-6-7-23/h2-3,5,9,13,23H,4,6-8,10-11H2,1H3,(H2,19,20,21,22) |
| InChIKey | NZZCAMAGFPYDAJ-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 92.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |