C19H23N5O2 — CID 126428211
2-[[4-(1H-indol-2-ylmethylamino)-6-[(3R)-oxolan-3-yl]pyrimidin-2-yl]amino]ethanol (PubChem CID 126428211) has the molecular formula C19H23N5O2 and a molecular weight of 353.43 g/mol. Its IUPAC name is 2-[[4-(1H-indol-2-ylmethylamino)-6-[(3R)-oxolan-3-yl]pyrimidin-2-yl]amino]ethanol.
| Compound Name | 2-[[4-(1H-indol-2-ylmethylamino)-6-[(3R)-oxolan-3-yl]pyrimidin-2-yl]amino]ethanol |
|---|---|
| PubChem CID | 126428211 |
| Molecular Formula | C19H23N5O2 |
| Molecular Weight | 353.43 g/mol |
| Exact Mass | 353.19 |
| IUPAC Name | 2-[[4-(1H-indol-2-ylmethylamino)-6-[(3R)-oxolan-3-yl]pyrimidin-2-yl]amino]ethanol |
| SMILES | OCCNc1nc(NCc2cc3ccccc3[nH]2)cc([C@H]2CCOC2)n1 |
| InChI | InChI=1S/C19H23N5O2/c25-7-6-20-19-23-17(14-5-8-26-12-14)10-18(24-19)21-11-15-9-13-3-1-2-4-16(13)22-15/h1-4,9-10,14,22,25H,5-8,11-12H2,(H2,20,21,23,24)/t14-/m0/s1 |
| InChIKey | JQHTZYRQBFAUEY-AWEZNQCLSA-N |
| XLogP | 2.48 |
| TPSA | 95.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.43 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |