C16H24N6O2 — CID 119068065
2-[[4-[(3-ethylimidazol-4-yl)methylamino]-6-(oxolan-3-yl)pyrimidin-2-yl]amino]ethanol (PubChem CID 119068065) has the molecular formula C16H24N6O2 and a molecular weight of 332.41 g/mol. Its IUPAC name is 2-[[4-[(3-ethylimidazol-4-yl)methylamino]-6-(oxolan-3-yl)pyrimidin-2-yl]amino]ethanol.
| Compound Name | 2-[[4-[(3-ethylimidazol-4-yl)methylamino]-6-(oxolan-3-yl)pyrimidin-2-yl]amino]ethanol |
|---|---|
| PubChem CID | 119068065 |
| Molecular Formula | C16H24N6O2 |
| Molecular Weight | 332.41 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | 2-[[4-[(3-ethylimidazol-4-yl)methylamino]-6-(oxolan-3-yl)pyrimidin-2-yl]amino]ethanol |
| SMILES | CCn1cncc1CNc1cc(C2CCOC2)nc(NCCO)n1 |
| InChI | InChI=1S/C16H24N6O2/c1-2-22-11-17-8-13(22)9-19-15-7-14(12-3-6-24-10-12)20-16(21-15)18-4-5-23/h7-8,11-12,23H,2-6,9-10H2,1H3,(H2,18,19,20,21) |
| InChIKey | AAYUDYJHQPVYAQ-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 97.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.41 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |