C17H24N4O2S — CID 118765909
2-[[4-[2-(3-methylthiophen-2-yl)ethylamino]-6-(oxolan-3-yl)pyrimidin-2-yl]amino]ethanol (PubChem CID 118765909) has the molecular formula C17H24N4O2S and a molecular weight of 348.47 g/mol. Its IUPAC name is 2-[[4-[2-(3-methylthiophen-2-yl)ethylamino]-6-(oxolan-3-yl)pyrimidin-2-yl]amino]ethanol.
| Compound Name | 2-[[4-[2-(3-methylthiophen-2-yl)ethylamino]-6-(oxolan-3-yl)pyrimidin-2-yl]amino]ethanol |
|---|---|
| PubChem CID | 118765909 |
| Molecular Formula | C17H24N4O2S |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | 2-[[4-[2-(3-methylthiophen-2-yl)ethylamino]-6-(oxolan-3-yl)pyrimidin-2-yl]amino]ethanol |
| SMILES | Cc1ccsc1CCNc1cc(C2CCOC2)nc(NCCO)n1 |
| InChI | InChI=1S/C17H24N4O2S/c1-12-4-9-24-15(12)2-5-18-16-10-14(13-3-8-23-11-13)20-17(21-16)19-6-7-22/h4,9-10,13,22H,2-3,5-8,11H2,1H3,(H2,18,19,20,21) |
| InChIKey | ADPUHMCHCYWRIT-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 79.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |