C20H23N5O2 — CID 126451520
2-[[4-[(3S)-oxolan-3-yl]-6-(quinolin-4-ylmethylamino)pyrimidin-2-yl]amino]ethanol (PubChem CID 126451520) has the molecular formula C20H23N5O2 and a molecular weight of 365.44 g/mol. Its IUPAC name is 2-[[4-[(3S)-oxolan-3-yl]-6-(quinolin-4-ylmethylamino)pyrimidin-2-yl]amino]ethanol.
| Compound Name | 2-[[4-[(3S)-oxolan-3-yl]-6-(quinolin-4-ylmethylamino)pyrimidin-2-yl]amino]ethanol |
|---|---|
| PubChem CID | 126451520 |
| Molecular Formula | C20H23N5O2 |
| Molecular Weight | 365.44 g/mol |
| Exact Mass | 365.19 |
| IUPAC Name | 2-[[4-[(3S)-oxolan-3-yl]-6-(quinolin-4-ylmethylamino)pyrimidin-2-yl]amino]ethanol |
| SMILES | OCCNc1nc(NCc2ccnc3ccccc23)cc([C@@H]2CCOC2)n1 |
| InChI | InChI=1S/C20H23N5O2/c26-9-8-22-20-24-18(15-6-10-27-13-15)11-19(25-20)23-12-14-5-7-21-17-4-2-1-3-16(14)17/h1-5,7,11,15,26H,6,8-10,12-13H2,(H2,22,23,24,25)/t15-/m1/s1 |
| InChIKey | OGNDKDDAFTUCPF-OAHLLOKOSA-N |
| XLogP | 2.55 |
| TPSA | 92.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.44 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |