C21H28N4O3 — CID 126437019
1-[4-[2-(3,4-dimethylphenoxy)ethylamino]-6-[(3R)-oxolan-3-yl]pyrimidin-2-yl]azetidin-3-ol (PubChem CID 126437019) has the molecular formula C21H28N4O3 and a molecular weight of 384.48 g/mol. Its IUPAC name is 1-[4-[2-(3,4-dimethylphenoxy)ethylamino]-6-[(3R)-oxolan-3-yl]pyrimidin-2-yl]azetidin-3-ol.
| Compound Name | 1-[4-[2-(3,4-dimethylphenoxy)ethylamino]-6-[(3R)-oxolan-3-yl]pyrimidin-2-yl]azetidin-3-ol |
|---|---|
| PubChem CID | 126437019 |
| Molecular Formula | C21H28N4O3 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.22 |
| IUPAC Name | 1-[4-[2-(3,4-dimethylphenoxy)ethylamino]-6-[(3R)-oxolan-3-yl]pyrimidin-2-yl]azetidin-3-ol |
| SMILES | Cc1ccc(OCCNc2cc([C@H]3CCOC3)nc(N3CC(O)C3)n2)cc1C |
| InChI | InChI=1S/C21H28N4O3/c1-14-3-4-18(9-15(14)2)28-8-6-22-20-10-19(16-5-7-27-13-16)23-21(24-20)25-11-17(26)12-25/h3-4,9-10,16-17,26H,5-8,11-13H2,1-2H3,(H,22,23,24)/t16-/m0/s1 |
| InChIKey | VVXDBMNNNHHUQD-INIZCTEOSA-N |
| XLogP | 2.27 |
| TPSA | 79.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|