C17H20N4O4 — CID 118770286
3-[2-[[2-amino-6-(oxolan-3-yl)pyrimidin-4-yl]amino]ethoxy]benzoic acid (PubChem CID 118770286) has the molecular formula C17H20N4O4 and a molecular weight of 344.37 g/mol. Its IUPAC name is 3-[2-[[2-amino-6-(oxolan-3-yl)pyrimidin-4-yl]amino]ethoxy]benzoic acid.
| Compound Name | 3-[2-[[2-amino-6-(oxolan-3-yl)pyrimidin-4-yl]amino]ethoxy]benzoic acid |
|---|---|
| PubChem CID | 118770286 |
| Molecular Formula | C17H20N4O4 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | 3-[2-[[2-amino-6-(oxolan-3-yl)pyrimidin-4-yl]amino]ethoxy]benzoic acid |
| SMILES | Nc1nc(NCCOc2cccc(C(=O)O)c2)cc(C2CCOC2)n1 |
| InChI | InChI=1S/C17H20N4O4/c18-17-20-14(12-4-6-24-10-12)9-15(21-17)19-5-7-25-13-3-1-2-11(8-13)16(22)23/h1-3,8-9,12H,4-7,10H2,(H,22,23)(H3,18,19,20,21) |
| InChIKey | VKIUCMMEHGDUJI-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 119.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|