C17H19N3O4 — CID 125165387
3-[2-[[6-[(3R)-oxolan-3-yl]pyrimidin-4-yl]amino]ethoxy]benzoic acid (PubChem CID 125165387) has the molecular formula C17H19N3O4 and a molecular weight of 329.36 g/mol. Its IUPAC name is 3-[2-[[6-[(3R)-oxolan-3-yl]pyrimidin-4-yl]amino]ethoxy]benzoic acid.
| Compound Name | 3-[2-[[6-[(3R)-oxolan-3-yl]pyrimidin-4-yl]amino]ethoxy]benzoic acid |
|---|---|
| PubChem CID | 125165387 |
| Molecular Formula | C17H19N3O4 |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | 3-[2-[[6-[(3R)-oxolan-3-yl]pyrimidin-4-yl]amino]ethoxy]benzoic acid |
| SMILES | O=C(O)c1cccc(OCCNc2cc([C@H]3CCOC3)ncn2)c1 |
| InChI | InChI=1S/C17H19N3O4/c21-17(22)12-2-1-3-14(8-12)24-7-5-18-16-9-15(19-11-20-16)13-4-6-23-10-13/h1-3,8-9,11,13H,4-7,10H2,(H,21,22)(H,18,19,20)/t13-/m0/s1 |
| InChIKey | HZRXQKANGDXQPI-ZDUSSCGKSA-N |
| XLogP | 2.17 |
| TPSA | 93.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|