C17H24N6O2 — CID 118793511
1-[4-(3-imidazol-1-ylpropylamino)-6-(oxolan-3-yl)pyrimidin-2-yl]azetidin-3-ol (PubChem CID 118793511) has the molecular formula C17H24N6O2 and a molecular weight of 344.42 g/mol. Its IUPAC name is 1-[4-(3-imidazol-1-ylpropylamino)-6-(oxolan-3-yl)pyrimidin-2-yl]azetidin-3-ol.
| Compound Name | 1-[4-(3-imidazol-1-ylpropylamino)-6-(oxolan-3-yl)pyrimidin-2-yl]azetidin-3-ol |
|---|---|
| PubChem CID | 118793511 |
| Molecular Formula | C17H24N6O2 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | 1-[4-(3-imidazol-1-ylpropylamino)-6-(oxolan-3-yl)pyrimidin-2-yl]azetidin-3-ol |
| SMILES | OC1CN(c2nc(NCCCn3ccnc3)cc(C3CCOC3)n2)C1 |
| InChI | InChI=1S/C17H24N6O2/c24-14-9-23(10-14)17-20-15(13-2-7-25-11-13)8-16(21-17)19-3-1-5-22-6-4-18-12-22/h4,6,8,12-14,24H,1-3,5,7,9-11H2,(H,19,20,21) |
| InChIKey | XOQBXFNXUUTLMU-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 88.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|