C16H23NO4 — CID 11907490
propyl (1S,5R,6S,7R)-3-[(2S)-butan-2-yl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxylate (PubChem CID 11907490) has the molecular formula C16H23NO4 and a molecular weight of 293.36 g/mol. Its IUPAC name is propyl (1S,5R,6S,7R)-3-[(2S)-butan-2-yl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxylate.
| Compound Name | propyl (1S,5R,6S,7R)-3-[(2S)-butan-2-yl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxylate |
|---|---|
| PubChem CID | 11907490 |
| Molecular Formula | C16H23NO4 |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | propyl (1S,5R,6S,7R)-3-[(2S)-butan-2-yl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxylate |
| SMILES | CCCOC(=O)[C@H]1[C@H]2C(=O)N([C@@H](C)CC)C[C@]23C=C[C@H]1O3 |
| InChI | InChI=1S/C16H23NO4/c1-4-8-20-15(19)12-11-6-7-16(21-11)9-17(10(3)5-2)14(18)13(12)16/h6-7,10-13H,4-5,8-9H2,1-3H3/t10-,11+,12+,13-,16+/m0/s1 |
| InChIKey | KTPGBONFTJRHGT-SUNOKAMTSA-N |
| XLogP | 1.52 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|