C16H23NO4 — CID 18556295
propyl (1S,5R,6S,7S)-3-butyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxylate (PubChem CID 18556295) has the molecular formula C16H23NO4 and a molecular weight of 293.36 g/mol. Its IUPAC name is propyl (1S,5R,6S,7S)-3-butyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxylate.
| Compound Name | propyl (1S,5R,6S,7S)-3-butyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxylate |
|---|---|
| PubChem CID | 18556295 |
| Molecular Formula | C16H23NO4 |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | propyl (1S,5R,6S,7S)-3-butyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxylate |
| SMILES | CCCCN1C[C@@]23C=C[C@H](O2)[C@@H](C(=O)OCCC)[C@H]3C1=O |
| InChI | InChI=1S/C16H23NO4/c1-3-5-8-17-10-16-7-6-11(21-16)12(13(16)14(17)18)15(19)20-9-4-2/h6-7,11-13H,3-5,8-10H2,1-2H3/t11-,12+,13-,16+/m0/s1 |
| InChIKey | DYOKCTGJUKISSP-RSUWNVLCSA-N |
| XLogP | 1.52 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|