C13H16NO4- — CID 22851922
(1R,5S,6S,7R)-3-butyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxylate (PubChem CID 22851922) has the molecular formula C13H16NO4- and a molecular weight of 250.27 g/mol. Its IUPAC name is (1R,5S,6S,7R)-3-butyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxylate.
| Compound Name | (1R,5S,6S,7R)-3-butyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxylate |
|---|---|
| PubChem CID | 22851922 |
| Molecular Formula | C13H16NO4- |
| Molecular Weight | 250.27 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | (1R,5S,6S,7R)-3-butyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxylate |
| SMILES | CCCCN1C[C@]23C=C[C@@H](O2)[C@@H](C(=O)[O-])[C@@H]3C1=O |
| InChI | InChI=1S/C13H17NO4/c1-2-3-6-14-7-13-5-4-8(18-13)9(12(16)17)10(13)11(14)15/h4-5,8-10H,2-3,6-7H2,1H3,(H,16,17)/p-1/t8-,9-,10-,13+/m1/s1 |
| InChIKey | NDFHHBIZCGCWAK-PRFIWBCESA-M |
| XLogP | -0.68 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.27 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|