C18H19N2O4- — CID 23308668
(1S,5S,6R,7S)-3-[[4-(dimethylamino)phenyl]methyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxylate (PubChem CID 23308668) has the molecular formula C18H19N2O4- and a molecular weight of 327.36 g/mol. Its IUPAC name is (1S,5S,6R,7S)-3-[[4-(dimethylamino)phenyl]methyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxylate.
| Compound Name | (1S,5S,6R,7S)-3-[[4-(dimethylamino)phenyl]methyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxylate |
|---|---|
| PubChem CID | 23308668 |
| Molecular Formula | C18H19N2O4- |
| Molecular Weight | 327.36 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | (1S,5S,6R,7S)-3-[[4-(dimethylamino)phenyl]methyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxylate |
| SMILES | CN(C)c1ccc(CN2C[C@@]34C=C[C@H](O3)[C@H](C(=O)[O-])[C@@H]4C2=O)cc1 |
| InChI | InChI=1S/C18H20N2O4/c1-19(2)12-5-3-11(4-6-12)9-20-10-18-8-7-13(24-18)14(17(22)23)15(18)16(20)21/h3-8,13-15H,9-10H2,1-2H3,(H,22,23)/p-1/t13-,14-,15+,18+/m0/s1 |
| InChIKey | WBLRWQFVVHCCLM-OIPACUDHSA-M |
| XLogP | -0.22 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.36 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|