C14H12NO5- — CID 11920322
(1S,5R,6S,7R)-3-(furan-2-ylmethyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxylate (PubChem CID 11920322) has the molecular formula C14H12NO5- and a molecular weight of 274.25 g/mol. Its IUPAC name is (1S,5R,6S,7R)-3-(furan-2-ylmethyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxylate.
| Compound Name | (1S,5R,6S,7R)-3-(furan-2-ylmethyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxylate |
|---|---|
| PubChem CID | 11920322 |
| Molecular Formula | C14H12NO5- |
| Molecular Weight | 274.25 g/mol |
| Exact Mass | 274.07 |
| IUPAC Name | (1S,5R,6S,7R)-3-(furan-2-ylmethyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxylate |
| SMILES | O=C([O-])[C@H]1[C@H]2C(=O)N(Cc3ccco3)C[C@]23C=C[C@H]1O3 |
| InChI | InChI=1S/C14H13NO5/c16-12-11-10(13(17)18)9-3-4-14(11,20-9)7-15(12)6-8-2-1-5-19-8/h1-5,9-11H,6-7H2,(H,17,18)/p-1/t9-,10-,11+,14-/m1/s1 |
| InChIKey | YOOFQLMTHFOERW-NJBDSQKTSA-M |
| XLogP | -0.69 |
| TPSA | 82.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.25 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|