About CID 119078988
CID 119078988 (PubChem CID 119078988) has the molecular formula C18H17Ge
and a molecular weight of 305.94 g/mol.
Molecular Properties
| Compound Name | CID 119078988 |
| PubChem CID | 119078988 |
| Molecular Formula | C18H17Ge |
| Molecular Weight | 305.94 g/mol |
| Exact Mass | 307.05 |
| IUPAC Name | — |
| SMILES | C[Ge](C)c1ccccc1-c1ccc2ccccc2c1 |
| InChI | InChI=1S/C18H17Ge/c1-19(2)18-10-6-5-9-17(18)16-12-11-14-7-3-4-8-15(14)13-16/h3-13H,1-2H3 |
| InChIKey | YIRMHUIYBGNDBF-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.94 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze CID 119078988 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 119078988?
The IUPAC name of CID 119078988 (CID 119078988) is not available.
What is the SMILES notation for CID 119078988?
The canonical SMILES for CID 119078988 is C[Ge](C)c1ccccc1-c1ccc2ccccc2c1.
What is the InChIKey of CID 119078988?
The InChIKey is YIRMHUIYBGNDBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17Ge/c1-19(2)18-10-6-5-9-17(18)16-12-11-14-7-3-4-8-15(14)13-16/h3-13H,1-2H3.
What are the key properties of CID 119078988?
CID 119078988 has a molecular weight of 305.94 g/mol, XLogP of 4.47, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 119078988 is sourced from PubChem (CID 119078988), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).