C11H18O — CID 119079260
5,6-dideuterio-7-[(2-methylpropan-2-yl)oxy]bicyclo[2.2.1]hept-2-ene (PubChem CID 119079260) has the molecular formula C11H18O and a molecular weight of 168.28 g/mol. Its IUPAC name is 5,6-dideuterio-7-[(2-methylpropan-2-yl)oxy]bicyclo[2.2.1]hept-2-ene.
| Compound Name | 5,6-dideuterio-7-[(2-methylpropan-2-yl)oxy]bicyclo[2.2.1]hept-2-ene |
|---|---|
| PubChem CID | 119079260 |
| Molecular Formula | C11H18O |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.15 |
| IUPAC Name | 5,6-dideuterio-7-[(2-methylpropan-2-yl)oxy]bicyclo[2.2.1]hept-2-ene |
| SMILES | [2H]C1C([2H])C2C=CC1C2OC(C)(C)C |
| InChI | InChI=1S/C11H18O/c1-11(2,3)12-10-8-4-5-9(10)7-6-8/h4-5,8-10H,6-7H2,1-3H3/i6D,7D |
| InChIKey | UMDQECVVQDRXIA-QFIQSOQBSA-N |
| XLogP | 2.77 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|