C8H10Br2N2 — CID 119081596
4,6-dibromo-2-(2-methylpropyl)pyrimidine (PubChem CID 119081596) has the molecular formula C8H10Br2N2 and a molecular weight of 293.99 g/mol. Its IUPAC name is 4,6-dibromo-2-(2-methylpropyl)pyrimidine.
| Compound Name | 4,6-dibromo-2-(2-methylpropyl)pyrimidine |
|---|---|
| PubChem CID | 119081596 |
| Molecular Formula | C8H10Br2N2 |
| Molecular Weight | 293.99 g/mol |
| Exact Mass | 291.92 |
| IUPAC Name | 4,6-dibromo-2-(2-methylpropyl)pyrimidine |
| SMILES | CC(C)Cc1nc(Br)cc(Br)n1 |
| InChI | InChI=1S/C8H10Br2N2/c1-5(2)3-8-11-6(9)4-7(10)12-8/h4-5H,3H2,1-2H3 |
| InChIKey | JADQXXOQCXUNIO-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.99 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |