C5H4INO3 — CID 119081639
methyl 4-iodo-1,3-oxazole-5-carboxylate (PubChem CID 119081639) has the molecular formula C5H4INO3 and a molecular weight of 252.99 g/mol. Its IUPAC name is methyl 4-iodo-1,3-oxazole-5-carboxylate.
| Compound Name | methyl 4-iodo-1,3-oxazole-5-carboxylate |
|---|---|
| PubChem CID | 119081639 |
| Molecular Formula | C5H4INO3 |
| Molecular Weight | 252.99 g/mol |
| Exact Mass | 252.92 |
| IUPAC Name | methyl 4-iodo-1,3-oxazole-5-carboxylate |
| SMILES | COC(=O)c1ocnc1I |
| InChI | InChI=1S/C5H4INO3/c1-9-5(8)3-4(6)7-2-10-3/h2H,1H3 |
| InChIKey | DKADPLPTYXDPGP-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.99 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|