About methyl 5-(aminomethyl)-1,3-oxazole-4-carboxylate;hydrochloride
methyl 5-(aminomethyl)-1,3-oxazole-4-carboxylate;hydrochloride (PubChem CID 110210984) has the molecular formula C6H9ClN2O3
and a molecular weight of 192.60 g/mol. Its IUPAC name is methyl 5-(aminomethyl)-1,3-oxazole-4-carboxylate;hydrochloride.
Analyze methyl 5-(aminomethyl)-1,3-oxazole-4-carboxylate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-(aminomethyl)-1,3-oxazole-4-carboxylate;hydrochloride?
The IUPAC name of methyl 5-(aminomethyl)-1,3-oxazole-4-carboxylate;hydrochloride (CID 110210984) is methyl 5-(aminomethyl)-1,3-oxazole-4-carboxylate;hydrochloride.
What is the SMILES notation for methyl 5-(aminomethyl)-1,3-oxazole-4-carboxylate;hydrochloride?
The canonical SMILES for methyl 5-(aminomethyl)-1,3-oxazole-4-carboxylate;hydrochloride is COC(=O)c1ncoc1CN.Cl.
What is the InChIKey of methyl 5-(aminomethyl)-1,3-oxazole-4-carboxylate;hydrochloride?
The InChIKey is DWHJLTWDXWXQSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2O3.ClH/c1-10-6(9)5-4(2-7)11-3-8-5;/h3H,2,7H2,1H3;1H.
What are the key properties of methyl 5-(aminomethyl)-1,3-oxazole-4-carboxylate;hydrochloride?
methyl 5-(aminomethyl)-1,3-oxazole-4-carboxylate;hydrochloride has a molecular weight of 192.60 g/mol, XLogP of 0.34, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-(aminomethyl)-1,3-oxazole-4-carboxylate;hydrochloride is sourced from PubChem (CID 110210984), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).