C6H8N2O3 — CID 117275266
5-(2-aminoethyl)-1,3-oxazole-4-carboxylic acid (PubChem CID 117275266) has the molecular formula C6H8N2O3 and a molecular weight of 156.14 g/mol. Its IUPAC name is 5-(2-aminoethyl)-1,3-oxazole-4-carboxylic acid.
| Compound Name | 5-(2-aminoethyl)-1,3-oxazole-4-carboxylic acid |
|---|---|
| PubChem CID | 117275266 |
| Molecular Formula | C6H8N2O3 |
| Molecular Weight | 156.14 g/mol |
| Exact Mass | 156.05 |
| IUPAC Name | 5-(2-aminoethyl)-1,3-oxazole-4-carboxylic acid |
| SMILES | NCCc1ocnc1C(=O)O |
| InChI | InChI=1S/C6H8N2O3/c7-2-1-4-5(6(9)10)8-3-11-4/h3H,1-2,7H2,(H,9,10) |
| InChIKey | CSVRKHXIMPDNTM-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.14 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |