C11H11N3O2 — CID 100802146
5-benzyl-1,3-oxazole-4-carbohydrazide (PubChem CID 100802146) has the molecular formula C11H11N3O2 and a molecular weight of 217.23 g/mol. Its IUPAC name is 5-benzyl-1,3-oxazole-4-carbohydrazide.
| Compound Name | 5-benzyl-1,3-oxazole-4-carbohydrazide |
|---|---|
| PubChem CID | 100802146 |
| Molecular Formula | C11H11N3O2 |
| Molecular Weight | 217.23 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | 5-benzyl-1,3-oxazole-4-carbohydrazide |
| SMILES | NNC(=O)c1ncoc1Cc1ccccc1 |
| InChI | InChI=1S/C11H11N3O2/c12-14-11(15)10-9(16-7-13-10)6-8-4-2-1-3-5-8/h1-5,7H,6,12H2,(H,14,15) |
| InChIKey | BNSVPBMQHYVRHP-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.23 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|