C12H14N2O — CID 112545403
1-(4-benzyl-1,3-oxazol-5-yl)-N-methylmethanamine (PubChem CID 112545403) has the molecular formula C12H14N2O and a molecular weight of 202.26 g/mol. Its IUPAC name is 1-(4-benzyl-1,3-oxazol-5-yl)-N-methylmethanamine.
| Compound Name | 1-(4-benzyl-1,3-oxazol-5-yl)-N-methylmethanamine |
|---|---|
| PubChem CID | 112545403 |
| Molecular Formula | C12H14N2O |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | 1-(4-benzyl-1,3-oxazol-5-yl)-N-methylmethanamine |
| SMILES | CNCc1ocnc1Cc1ccccc1 |
| InChI | InChI=1S/C12H14N2O/c1-13-8-12-11(14-9-15-12)7-10-5-3-2-4-6-10/h2-6,9,13H,7-8H2,1H3 |
| InChIKey | BRXZDURZOXINBF-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |